C17H19ClN2O4 — CID 20538649
4-(4-chlorophenoxy)-2,2-diethyl-4-imidazol-1-yl-3-oxobutanoic acid (PubChem CID 20538649) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-2,2-diethyl-4-imidazol-1-yl-3-oxobutanoic acid.
| Compound Name | 4-(4-chlorophenoxy)-2,2-diethyl-4-imidazol-1-yl-3-oxobutanoic acid |
|---|---|
| PubChem CID | 20538649 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-(4-chlorophenoxy)-2,2-diethyl-4-imidazol-1-yl-3-oxobutanoic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C17H19ClN2O4/c1-3-17(4-2,16(22)23)14(21)15(20-10-9-19-11-20)24-13-7-5-12(18)6-8-13/h5-11,15H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | PFILJNAHOKUMIY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|