C17H22Cl2N2O2 — CID 23335433
1-[4-chloro-1-(4-chlorophenoxy)-2-ethoxy-3,3-dimethylbutyl]imidazole (PubChem CID 23335433) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 1-[4-chloro-1-(4-chlorophenoxy)-2-ethoxy-3,3-dimethylbutyl]imidazole.
| Compound Name | 1-[4-chloro-1-(4-chlorophenoxy)-2-ethoxy-3,3-dimethylbutyl]imidazole |
|---|---|
| PubChem CID | 23335433 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-[4-chloro-1-(4-chlorophenoxy)-2-ethoxy-3,3-dimethylbutyl]imidazole |
| SMILES | CCOC(C(Oc1ccc(Cl)cc1)n1ccnc1)C(C)(C)CCl |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-4-22-15(17(2,3)11-18)16(21-10-9-20-12-21)23-14-7-5-13(19)6-8-14/h5-10,12,15-16H,4,11H2,1-3H3 |
| InChIKey | OHRQKEDTOKWESJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|