C16H19ClN2O2 — CID 122173815
1-(4-chlorophenoxy)-1-imidazol-1-yl-4,4-dimethylpentan-2-one (PubChem CID 122173815) has the molecular formula C16H19ClN2O2 and a molecular weight of 306.79 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-1-imidazol-1-yl-4,4-dimethylpentan-2-one.
| Compound Name | 1-(4-chlorophenoxy)-1-imidazol-1-yl-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 122173815 |
| Molecular Formula | C16H19ClN2O2 |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-(4-chlorophenoxy)-1-imidazol-1-yl-4,4-dimethylpentan-2-one |
| SMILES | CC(C)(C)CC(=O)C(Oc1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C16H19ClN2O2/c1-16(2,3)10-14(20)15(19-9-8-18-11-19)21-13-6-4-12(17)5-7-13/h4-9,11,15H,10H2,1-3H3 |
| InChIKey | UYOOUWDEHUTKHD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |