C15H17ClN2O — CID 57000012
1-(4-chlorophenyl)-1-imidazol-1-yl-3,3-dimethylbutan-2-one (PubChem CID 57000012) has the molecular formula C15H17ClN2O and a molecular weight of 276.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-imidazol-1-yl-3,3-dimethylbutan-2-one.
| Compound Name | 1-(4-chlorophenyl)-1-imidazol-1-yl-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 57000012 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-(4-chlorophenyl)-1-imidazol-1-yl-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)C(c1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C15H17ClN2O/c1-15(2,3)14(19)13(18-9-8-17-10-18)11-4-6-12(16)7-5-11/h4-10,13H,1-3H3 |
| InChIKey | SRMXLQVGZDGKFM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |