C12H14N4O — CID 39730515
(3R)-N-phenyl-3-(1,2,4-triazol-1-yl)butanamide (PubChem CID 39730515) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is (3R)-N-phenyl-3-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | (3R)-N-phenyl-3-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 39730515 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (3R)-N-phenyl-3-(1,2,4-triazol-1-yl)butanamide |
| SMILES | C[C@H](CC(=O)Nc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C12H14N4O/c1-10(16-9-13-8-14-16)7-12(17)15-11-5-3-2-4-6-11/h2-6,8-10H,7H2,1H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | SSZQTRNBOVJWOD-SNVBAGLBSA-N |
| XLogP | 1.87 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |