About (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide
(3R)-3-(1,2,4-triazol-1-yl)butanehydrazide (PubChem CID 35399839) has the molecular formula C6H11N5O
and a molecular weight of 169.19 g/mol. Its IUPAC name is (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide.
Molecular Properties
| Compound Name | (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide |
| PubChem CID | 35399839 |
| Molecular Formula | C6H11N5O |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide |
| SMILES | C[C@H](CC(=O)NN)n1cncn1 |
| InChI | InChI=1S/C6H11N5O/c1-5(2-6(12)10-7)11-4-8-3-9-11/h3-5H,2,7H2,1H3,(H,10,12)/t5-/m1/s1 |
| InChIKey | FPYLDCZNWOPYJP-RXMQYKEDSA-N |
| XLogP | -0.78 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide?
The IUPAC name of (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide (CID 35399839) is (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide.
What is the SMILES notation for (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide?
The canonical SMILES for (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide is C[C@H](CC(=O)NN)n1cncn1.
What is the InChIKey of (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide?
The InChIKey is FPYLDCZNWOPYJP-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H11N5O/c1-5(2-6(12)10-7)11-4-8-3-9-11/h3-5H,2,7H2,1H3,(H,10,12)/t5-/m1/s1.
What are the key properties of (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide?
(3R)-3-(1,2,4-triazol-1-yl)butanehydrazide has a molecular weight of 169.19 g/mol, XLogP of -0.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-(1,2,4-triazol-1-yl)butanehydrazide is sourced from PubChem (CID 35399839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).