C8H14N4O2 — CID 83032149
N-[(2R)-2-hydroxypropyl]-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 83032149) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-2-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-2-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 83032149 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CC(C(=O)NC[C@@H](C)O)n1cncn1 |
| InChI | InChI=1S/C8H14N4O2/c1-6(13)3-10-8(14)7(2)12-5-9-4-11-12/h4-7,13H,3H2,1-2H3,(H,10,14)/t6-,7?/m1/s1 |
| InChIKey | KRFKNZAIGVVWNY-ULUSZKPHSA-N |
| XLogP | -0.66 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |