About N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide
N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide (PubChem CID 60729091) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide.
Molecular Properties
| Compound Name | N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide |
| PubChem CID | 60729091 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CCCC(C)NC(=O)C(C)n1cncn1 |
| InChI | InChI=1S/C10H18N4O/c1-4-5-8(2)13-10(15)9(3)14-7-11-6-12-14/h6-9H,4-5H2,1-3H3,(H,13,15) |
| InChIKey | KRWOYNBUCSTFMG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide?
The IUPAC name of N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide (CID 60729091) is N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide.
What is the SMILES notation for N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide?
The canonical SMILES for N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide is CCCC(C)NC(=O)C(C)n1cncn1.
What is the InChIKey of N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide?
The InChIKey is KRWOYNBUCSTFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c1-4-5-8(2)13-10(15)9(3)14-7-11-6-12-14/h6-9H,4-5H2,1-3H3,(H,13,15).
What are the key properties of N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide?
N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide has a molecular weight of 210.28 g/mol, XLogP of 1.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentan-2-yl-2-(1,2,4-triazol-1-yl)propanamide is sourced from PubChem (CID 60729091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).