C14H16N4O2 — CID 15943467
N-(4-acetylphenyl)-3-(1,2,4-triazol-1-yl)butanamide (PubChem CID 15943467) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-(4-acetylphenyl)-3-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-(4-acetylphenyl)-3-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 15943467 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(4-acetylphenyl)-3-(1,2,4-triazol-1-yl)butanamide |
| SMILES | CC(=O)c1ccc(NC(=O)CC(C)n2cncn2)cc1 |
| InChI | InChI=1S/C14H16N4O2/c1-10(18-9-15-8-16-18)7-14(20)17-13-5-3-12(4-6-13)11(2)19/h3-6,8-10H,7H2,1-2H3,(H,17,20) |
| InChIKey | DUYUFCFJRIZRHA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |