C10H9Cl3N2O2 — CID 134108818
N-(2,2,2-trichloro-1-formamidoethyl)benzamide (PubChem CID 134108818) has the molecular formula C10H9Cl3N2O2 and a molecular weight of 295.55 g/mol. Its IUPAC name is N-(2,2,2-trichloro-1-formamidoethyl)benzamide.
| Compound Name | N-(2,2,2-trichloro-1-formamidoethyl)benzamide |
|---|---|
| PubChem CID | 134108818 |
| Molecular Formula | C10H9Cl3N2O2 |
| Molecular Weight | 295.55 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | N-(2,2,2-trichloro-1-formamidoethyl)benzamide |
| SMILES | O=CNC(NC(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H9Cl3N2O2/c11-10(12,13)9(14-6-16)15-8(17)7-4-2-1-3-5-7/h1-6,9H,(H,14,16)(H,15,17) |
| InChIKey | LERQERCAODTRQL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|