C13H17NO2 — CID 59051843
N-(3,3-dimethyl-4-oxobutan-2-yl)benzamide (PubChem CID 59051843) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-(3,3-dimethyl-4-oxobutan-2-yl)benzamide.
| Compound Name | N-(3,3-dimethyl-4-oxobutan-2-yl)benzamide |
|---|---|
| PubChem CID | 59051843 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-(3,3-dimethyl-4-oxobutan-2-yl)benzamide |
| SMILES | CC(NC(=O)c1ccccc1)C(C)(C)C=O |
| InChI | InChI=1S/C13H17NO2/c1-10(13(2,3)9-15)14-12(16)11-7-5-4-6-8-11/h4-10H,1-3H3,(H,14,16) |
| InChIKey | CCGAHIACHBUCDX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|