C10H10Cl3N3OS — CID 3281860
N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]formamide (PubChem CID 3281860) has the molecular formula C10H10Cl3N3OS and a molecular weight of 326.64 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]formamide.
| Compound Name | N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]formamide |
|---|---|
| PubChem CID | 3281860 |
| Molecular Formula | C10H10Cl3N3OS |
| Molecular Weight | 326.64 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | N-[2,2,2-trichloro-1-(phenylcarbamothioylamino)ethyl]formamide |
| SMILES | O=CNC(NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H10Cl3N3OS/c11-10(12,13)8(14-6-17)16-9(18)15-7-4-2-1-3-5-7/h1-6,8H,(H,14,17)(H2,15,16,18) |
| InChIKey | FOVMVDFHECZEPP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|