C13H15N3O — CID 666101
1-phenyl-2-(1,2,4-triazol-1-yl)pentan-1-one (PubChem CID 666101) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-phenyl-2-(1,2,4-triazol-1-yl)pentan-1-one.
| Compound Name | 1-phenyl-2-(1,2,4-triazol-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 666101 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 1-phenyl-2-(1,2,4-triazol-1-yl)pentan-1-one |
| SMILES | CCCC(C(=O)c1ccccc1)n1cncn1 |
| InChI | InChI=1S/C13H15N3O/c1-2-6-12(16-10-14-9-15-16)13(17)11-7-4-3-5-8-11/h3-5,7-10,12H,2,6H2,1H3 |
| InChIKey | GIASLOOCOYGRGM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |