C20H19Cl2N3O3 — CID 168655163
1-(3,4-dichlorophenyl)-4-(2-phenoxyethoxy)-2-(1,2,4-triazol-1-yl)butan-1-one (PubChem CID 168655163) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-(2-phenoxyethoxy)-2-(1,2,4-triazol-1-yl)butan-1-one.
| Compound Name | 1-(3,4-dichlorophenyl)-4-(2-phenoxyethoxy)-2-(1,2,4-triazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 168655163 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-(2-phenoxyethoxy)-2-(1,2,4-triazol-1-yl)butan-1-one |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C(CCOCCOc1ccccc1)n1cncn1 |
| InChI | InChI=1S/C20H19Cl2N3O3/c21-17-7-6-15(12-18(17)22)20(26)19(25-14-23-13-24-25)8-9-27-10-11-28-16-4-2-1-3-5-16/h1-7,12-14,19H,8-11H2 |
| InChIKey | SDXCZKBDKLAGEF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|