C19H18Cl2N4O — CID 88692892
2-chloro-1-(4-chlorophenyl)-N-(3-phenoxypropyl)-2-(1,2,4-triazol-1-yl)ethanimine (PubChem CID 88692892) has the molecular formula C19H18Cl2N4O and a molecular weight of 389.29 g/mol. Its IUPAC name is 2-chloro-1-(4-chlorophenyl)-N-(3-phenoxypropyl)-2-(1,2,4-triazol-1-yl)ethanimine.
| Compound Name | 2-chloro-1-(4-chlorophenyl)-N-(3-phenoxypropyl)-2-(1,2,4-triazol-1-yl)ethanimine |
|---|---|
| PubChem CID | 88692892 |
| Molecular Formula | C19H18Cl2N4O |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-chloro-1-(4-chlorophenyl)-N-(3-phenoxypropyl)-2-(1,2,4-triazol-1-yl)ethanimine |
| SMILES | Clc1ccc(/C(=N\CCCOc2ccccc2)C(Cl)n2cncn2)cc1 |
| InChI | InChI=1S/C19H18Cl2N4O/c20-16-9-7-15(8-10-16)18(19(21)25-14-22-13-24-25)23-11-4-12-26-17-5-2-1-3-6-17/h1-3,5-10,13-14,19H,4,11-12H2/b23-18+ |
| InChIKey | SPLUBBJVEIHQJK-PTGBLXJZSA-N |
| XLogP | 4.63 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|