C12H14N4O — CID 40530681
(NZ)-N-[(4R)-4-phenyl-4-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine (PubChem CID 40530681) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is (NZ)-N-[(4R)-4-phenyl-4-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4R)-4-phenyl-4-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 40530681 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (NZ)-N-[(4R)-4-phenyl-4-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine |
| SMILES | C/C(C[C@H](c1ccccc1)n1cncn1)=N/O |
| InChI | InChI=1S/C12H14N4O/c1-10(15-17)7-12(16-9-13-8-14-16)11-5-3-2-4-6-11/h2-6,8-9,12,17H,7H2,1H3/b15-10-/t12-/m1/s1 |
| InChIKey | DKKVDSCHGCCXBW-DYTQJMLRSA-N |
| XLogP | 2.11 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|