C14H19N3 — CID 140995716
1-(2-ethyl-1-phenylbutyl)-1,2,4-triazole (PubChem CID 140995716) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 1-(2-ethyl-1-phenylbutyl)-1,2,4-triazole.
| Compound Name | 1-(2-ethyl-1-phenylbutyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 140995716 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-(2-ethyl-1-phenylbutyl)-1,2,4-triazole |
| SMILES | CCC(CC)C(c1ccccc1)n1cncn1 |
| InChI | InChI=1S/C14H19N3/c1-3-12(4-2)14(17-11-15-10-16-17)13-8-6-5-7-9-13/h5-12,14H,3-4H2,1-2H3 |
| InChIKey | JBFJCVDZEWCCMM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |