C16H20N4 — CID 154686601
5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole (PubChem CID 154686601) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole.
| Compound Name | 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole |
|---|---|
| PubChem CID | 154686601 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole |
| SMILES | CCC(CC)C(c1ccc2[nH]ccc2c1)n1cncn1 |
| InChI | InChI=1S/C16H20N4/c1-3-12(4-2)16(20-11-17-10-19-20)14-5-6-15-13(9-14)7-8-18-15/h5-12,16,18H,3-4H2,1-2H3 |
| InChIKey | UJZWHPBNTRFODH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |