About 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole
5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole (PubChem CID 154686601) has the molecular formula C16H20N4
and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole.
Molecular Properties
| Compound Name | 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole |
| PubChem CID | 154686601 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole |
| SMILES | CCC(CC)C(c1ccc2[nH]ccc2c1)n1cncn1 |
| InChI | InChI=1S/C16H20N4/c1-3-12(4-2)16(20-11-17-10-19-20)14-5-6-15-13(9-14)7-8-18-15/h5-12,16,18H,3-4H2,1-2H3 |
| InChIKey | UJZWHPBNTRFODH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole?
The IUPAC name of 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole (CID 154686601) is 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole.
What is the SMILES notation for 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole?
The canonical SMILES for 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole is CCC(CC)C(c1ccc2[nH]ccc2c1)n1cncn1.
What is the InChIKey of 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole?
The InChIKey is UJZWHPBNTRFODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4/c1-3-12(4-2)16(20-11-17-10-19-20)14-5-6-15-13(9-14)7-8-18-15/h5-12,16,18H,3-4H2,1-2H3.
What are the key properties of 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole?
5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole has a molecular weight of 268.36 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-ethyl-1-(1,2,4-triazol-1-yl)butyl]-1H-indole is sourced from PubChem (CID 154686601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).