About 5-butan-2-yl-1H-indole;molecular hydrogen
5-butan-2-yl-1H-indole;molecular hydrogen (PubChem CID 144711250) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 5-butan-2-yl-1H-indole;molecular hydrogen.
Molecular Properties
| Compound Name | 5-butan-2-yl-1H-indole;molecular hydrogen |
| PubChem CID | 144711250 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 5-butan-2-yl-1H-indole;molecular hydrogen |
| SMILES | CCC(C)c1ccc2[nH]ccc2c1.[H][H] |
| InChI | InChI=1S/C12H15N.H2/c1-3-9(2)10-4-5-12-11(8-10)6-7-13-12;/h4-9,13H,3H2,1-2H3;1H |
| InChIKey | DJVVTDKLVVHWFD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-butan-2-yl-1H-indole;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-1H-indole;molecular hydrogen?
The IUPAC name of 5-butan-2-yl-1H-indole;molecular hydrogen (CID 144711250) is 5-butan-2-yl-1H-indole;molecular hydrogen.
What is the SMILES notation for 5-butan-2-yl-1H-indole;molecular hydrogen?
The canonical SMILES for 5-butan-2-yl-1H-indole;molecular hydrogen is CCC(C)c1ccc2[nH]ccc2c1.[H][H].
What is the InChIKey of 5-butan-2-yl-1H-indole;molecular hydrogen?
The InChIKey is DJVVTDKLVVHWFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.H2/c1-3-9(2)10-4-5-12-11(8-10)6-7-13-12;/h4-9,13H,3H2,1-2H3;1H.
What are the key properties of 5-butan-2-yl-1H-indole;molecular hydrogen?
5-butan-2-yl-1H-indole;molecular hydrogen has a molecular weight of 175.28 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-1H-indole;molecular hydrogen is sourced from PubChem (CID 144711250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).