5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen

C17H29N — CID 143996683

IUPAC5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen
SMILESCC.CCCc1c[nH]c2ccc(C(C)CC)cc12.[H][H]
InChIInChI=1S/C15H21N.C2H6.H2/c1-4-6-13-10-16-15-8-7-12(9-14(13)15)11(3)5-2;1-2;/h7-11,16H,4-6H2,1-3H3;1-2H3;1H
InChIKeyZYEBUKMAIAKAJB-UHFFFAOYSA-N
MW247.43 g/mol
LogP5.91
Rot. Bonds4

About 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen

5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen (PubChem CID 143996683) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen.

Molecular Properties

Compound Name5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen
PubChem CID143996683
Molecular FormulaC17H29N
Molecular Weight247.43 g/mol
Exact Mass247.23
IUPAC Name5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen
SMILESCC.CCCc1c[nH]c2ccc(C(C)CC)cc12.[H][H]
InChIInChI=1S/C15H21N.C2H6.H2/c1-4-6-13-10-16-15-8-7-12(9-14(13)15)11(3)5-2;1-2;/h7-11,16H,4-6H2,1-3H3;1-2H3;1H
InChIKeyZYEBUKMAIAKAJB-UHFFFAOYSA-N
XLogP5.91
TPSA15.79 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500247.43
LogP ≤ 55.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen?
The IUPAC name of 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen (CID 143996683) is 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen.
What is the SMILES notation for 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen?
The canonical SMILES for 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen is CC.CCCc1c[nH]c2ccc(C(C)CC)cc12.[H][H].
What is the InChIKey of 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen?
The InChIKey is ZYEBUKMAIAKAJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N.C2H6.H2/c1-4-6-13-10-16-15-8-7-12(9-14(13)15)11(3)5-2;1-2;/h7-11,16H,4-6H2,1-3H3;1-2H3;1H.
What are the key properties of 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen?
5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen has a molecular weight of 247.43 g/mol, XLogP of 5.91, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-3-propyl-1H-indole;ethane;molecular hydrogen is sourced from PubChem (CID 143996683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).