About hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine)
hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine) (PubChem CID 15140319) has the molecular formula C26H34N4O4
and a molecular weight of 466.58 g/mol. Its IUPAC name is hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine).
Molecular Properties
| Compound Name | hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine) |
| PubChem CID | 15140319 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine) |
| SMILES | CC(N)c1ccc2[nH]ccc2c1.CC(N)c1ccc2[nH]ccc2c1.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/2C10H12N2.C6H10O4/c2*1-7(11)8-2-3-10-9(6-8)4-5-12-10;7-5(8)3-1-2-4-6(9)10/h2*2-7,12H,11H2,1H3;1-4H2,(H,7,8)(H,9,10) |
| InChIKey | XFDBIIBTWDDKML-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 158.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine)?
The IUPAC name of hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine) (CID 15140319) is hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine).
What is the SMILES notation for hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine)?
The canonical SMILES for hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine) is CC(N)c1ccc2[nH]ccc2c1.CC(N)c1ccc2[nH]ccc2c1.O=C(O)CCCCC(=O)O.
What is the InChIKey of hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine)?
The InChIKey is XFDBIIBTWDDKML-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H12N2.C6H10O4/c2*1-7(11)8-2-3-10-9(6-8)4-5-12-10;7-5(8)3-1-2-4-6(9)10/h2*2-7,12H,11H2,1H3;1-4H2,(H,7,8)(H,9,10).
What are the key properties of hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine)?
hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine) has a molecular weight of 466.58 g/mol, XLogP of 5.09, 7 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexanedioic acid;bis(1-(1H-indol-5-yl)ethanamine) is sourced from PubChem (CID 15140319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).