C17H15N3O — CID 40573311
(3R)-1,3-diphenyl-3-(1,2,4-triazol-1-yl)propan-1-one (PubChem CID 40573311) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is (3R)-1,3-diphenyl-3-(1,2,4-triazol-1-yl)propan-1-one.
| Compound Name | (3R)-1,3-diphenyl-3-(1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 40573311 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (3R)-1,3-diphenyl-3-(1,2,4-triazol-1-yl)propan-1-one |
| SMILES | O=C(C[C@H](c1ccccc1)n1cncn1)c1ccccc1 |
| InChI | InChI=1S/C17H15N3O/c21-17(15-9-5-2-6-10-15)11-16(20-13-18-12-19-20)14-7-3-1-4-8-14/h1-10,12-13,16H,11H2/t16-/m1/s1 |
| InChIKey | NKCCTAZODZIPNN-MRXNPFEDSA-N |
| XLogP | 3.14 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |