C20H17N5O — CID 155775820
N-[2-phenyl-2-(1,2,4-triazol-1-yl)ethyl]quinoline-2-carboxamide (PubChem CID 155775820) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[2-phenyl-2-(1,2,4-triazol-1-yl)ethyl]quinoline-2-carboxamide.
| Compound Name | N-[2-phenyl-2-(1,2,4-triazol-1-yl)ethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 155775820 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-[2-phenyl-2-(1,2,4-triazol-1-yl)ethyl]quinoline-2-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)n1cncn1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H17N5O/c26-20(18-11-10-15-6-4-5-9-17(15)24-18)22-12-19(25-14-21-13-23-25)16-7-2-1-3-8-16/h1-11,13-14,19H,12H2,(H,22,26) |
| InChIKey | FXVQXYSYJFXJJB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |