C18H14F2N2O2 — CID 38511415
N-[(2S)-2-(3,4-difluorophenyl)-2-hydroxyethyl]quinoline-2-carboxamide (PubChem CID 38511415) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is N-[(2S)-2-(3,4-difluorophenyl)-2-hydroxyethyl]quinoline-2-carboxamide.
| Compound Name | N-[(2S)-2-(3,4-difluorophenyl)-2-hydroxyethyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 38511415 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[(2S)-2-(3,4-difluorophenyl)-2-hydroxyethyl]quinoline-2-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1ccc(F)c(F)c1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H14F2N2O2/c19-13-7-5-12(9-14(13)20)17(23)10-21-18(24)16-8-6-11-3-1-2-4-15(11)22-16/h1-9,17,23H,10H2,(H,21,24)/t17-/m1/s1 |
| InChIKey | ZXCAPTGNBZKTJJ-QGZVFWFLSA-N |
| XLogP | 2.98 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |