About 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole
3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole (PubChem CID 14575038) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole |
| PubChem CID | 14575038 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole |
| SMILES | CC(c1noc2ccccc12)n1cncn1 |
| InChI | InChI=1S/C11H10N4O/c1-8(15-7-12-6-13-15)11-9-4-2-3-5-10(9)16-14-11/h2-8H,1H3 |
| InChIKey | PHHAFYQLQOIJDG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole?
The IUPAC name of 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole (CID 14575038) is 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole.
What is the SMILES notation for 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole?
The canonical SMILES for 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole is CC(c1noc2ccccc12)n1cncn1.
What is the InChIKey of 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole?
The InChIKey is PHHAFYQLQOIJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c1-8(15-7-12-6-13-15)11-9-4-2-3-5-10(9)16-14-11/h2-8H,1H3.
What are the key properties of 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole?
3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole has a molecular weight of 214.23 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(1,2,4-triazol-1-yl)ethyl]-1,2-benzoxazole is sourced from PubChem (CID 14575038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).