C21H15Cl3N2OS — CID 95864970
N-[(1S)-2,2,2-trichloro-1-phenothiazin-10-ylethyl]benzamide (PubChem CID 95864970) has the molecular formula C21H15Cl3N2OS and a molecular weight of 449.79 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-phenothiazin-10-ylethyl]benzamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-phenothiazin-10-ylethyl]benzamide |
|---|---|
| PubChem CID | 95864970 |
| Molecular Formula | C21H15Cl3N2OS |
| Molecular Weight | 449.79 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-phenothiazin-10-ylethyl]benzamide |
| SMILES | O=C(N[C@@H](N1c2ccccc2Sc2ccccc21)C(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C21H15Cl3N2OS/c22-21(23,24)20(25-19(27)14-8-2-1-3-9-14)26-15-10-4-6-12-17(15)28-18-13-7-5-11-16(18)26/h1-13,20H,(H,25,27)/t20-/m0/s1 |
| InChIKey | XCMLXJLDFPHQDC-FQEVSTJZSA-N |
| XLogP | 6.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.79 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|