About S-pyrimidin-4-yl N-phenylcarbamothioate
S-pyrimidin-4-yl N-phenylcarbamothioate (PubChem CID 88546954) has the molecular formula C11H9N3OS
and a molecular weight of 231.28 g/mol. Its IUPAC name is S-pyrimidin-4-yl N-phenylcarbamothioate.
Molecular Properties
| Compound Name | S-pyrimidin-4-yl N-phenylcarbamothioate |
| PubChem CID | 88546954 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | S-pyrimidin-4-yl N-phenylcarbamothioate |
| SMILES | O=C(Nc1ccccc1)Sc1ccncn1 |
| InChI | InChI=1S/C11H9N3OS/c15-11(14-9-4-2-1-3-5-9)16-10-6-7-12-8-13-10/h1-8H,(H,14,15) |
| InChIKey | TUJCECOKLYSQHI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pyrimidin-4-yl N-phenylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pyrimidin-4-yl N-phenylcarbamothioate?
The IUPAC name of S-pyrimidin-4-yl N-phenylcarbamothioate (CID 88546954) is S-pyrimidin-4-yl N-phenylcarbamothioate.
What is the SMILES notation for S-pyrimidin-4-yl N-phenylcarbamothioate?
The canonical SMILES for S-pyrimidin-4-yl N-phenylcarbamothioate is O=C(Nc1ccccc1)Sc1ccncn1.
What is the InChIKey of S-pyrimidin-4-yl N-phenylcarbamothioate?
The InChIKey is TUJCECOKLYSQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3OS/c15-11(14-9-4-2-1-3-5-9)16-10-6-7-12-8-13-10/h1-8H,(H,14,15).
What are the key properties of S-pyrimidin-4-yl N-phenylcarbamothioate?
S-pyrimidin-4-yl N-phenylcarbamothioate has a molecular weight of 231.28 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-pyrimidin-4-yl N-phenylcarbamothioate is sourced from PubChem (CID 88546954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).