About S-(phenylcarbamoyl) ethanethioate
S-(phenylcarbamoyl) ethanethioate (PubChem CID 130006234) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is S-(phenylcarbamoyl) ethanethioate.
Molecular Properties
| Compound Name | S-(phenylcarbamoyl) ethanethioate |
| PubChem CID | 130006234 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | S-(phenylcarbamoyl) ethanethioate |
| SMILES | CC(=O)SC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C9H9NO2S/c1-7(11)13-9(12)10-8-5-3-2-4-6-8/h2-6H,1H3,(H,10,12) |
| InChIKey | JNJPADCTJPFZRQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(phenylcarbamoyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(phenylcarbamoyl) ethanethioate?
The IUPAC name of S-(phenylcarbamoyl) ethanethioate (CID 130006234) is S-(phenylcarbamoyl) ethanethioate.
What is the SMILES notation for S-(phenylcarbamoyl) ethanethioate?
The canonical SMILES for S-(phenylcarbamoyl) ethanethioate is CC(=O)SC(=O)Nc1ccccc1.
What is the InChIKey of S-(phenylcarbamoyl) ethanethioate?
The InChIKey is JNJPADCTJPFZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c1-7(11)13-9(12)10-8-5-3-2-4-6-8/h2-6H,1H3,(H,10,12).
What are the key properties of S-(phenylcarbamoyl) ethanethioate?
S-(phenylcarbamoyl) ethanethioate has a molecular weight of 195.24 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(phenylcarbamoyl) ethanethioate is sourced from PubChem (CID 130006234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).