About S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate
S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate (PubChem CID 16686573) has the molecular formula C32H27N2O2S2Sb
and a molecular weight of 657.47 g/mol. Its IUPAC name is S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate.
Molecular Properties
| Compound Name | S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate |
| PubChem CID | 16686573 |
| Molecular Formula | C32H27N2O2S2Sb |
| Molecular Weight | 657.47 g/mol |
| Exact Mass | 656.06 |
| IUPAC Name | S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate |
| SMILES | O=C(Nc1ccccc1)S[Sb](SC(=O)Nc1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C7H7NOS.3C6H5.Sb/c2*9-7(10)8-6-4-2-1-3-5-6;3*1-2-4-6-5-3-1;/h2*1-5H,(H2,8,9,10);3*1-5H;/q;;;;;+2/p-2 |
| InChIKey | QUCPLHOQYLQBMQ-UHFFFAOYSA-L |
| XLogP | 7.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 657.47 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate?
The IUPAC name of S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate (CID 16686573) is S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate.
What is the SMILES notation for S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate?
The canonical SMILES for S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate is O=C(Nc1ccccc1)S[Sb](SC(=O)Nc1ccccc1)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate?
The InChIKey is QUCPLHOQYLQBMQ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H7NOS.3C6H5.Sb/c2*9-7(10)8-6-4-2-1-3-5-6;3*1-2-4-6-5-3-1;/h2*1-5H,(H2,8,9,10);3*1-5H;/q;;;;;+2/p-2.
What are the key properties of S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate?
S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate has a molecular weight of 657.47 g/mol, XLogP of 7.03, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[triphenyl(phenylcarbamoylsulfanyl)-λ5-stibanyl] N-phenylcarbamothioate is sourced from PubChem (CID 16686573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).