C20H14ClN5OS — CID 54198860
S-[[4-(4-chlorophenyl)-5-pyrimidin-4-yl-1H-imidazol-2-yl]] N-phenylcarbamothioate (PubChem CID 54198860) has the molecular formula C20H14ClN5OS and a molecular weight of 407.89 g/mol. Its IUPAC name is S-[[4-(4-chlorophenyl)-5-pyrimidin-4-yl-1H-imidazol-2-yl]] N-phenylcarbamothioate.
| Compound Name | S-[[4-(4-chlorophenyl)-5-pyrimidin-4-yl-1H-imidazol-2-yl]] N-phenylcarbamothioate |
|---|---|
| PubChem CID | 54198860 |
| Molecular Formula | C20H14ClN5OS |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | S-[[4-(4-chlorophenyl)-5-pyrimidin-4-yl-1H-imidazol-2-yl]] N-phenylcarbamothioate |
| SMILES | O=C(Nc1ccccc1)Sc1nc(-c2ccc(Cl)cc2)c(-c2ccncn2)[nH]1 |
| InChI | InChI=1S/C20H14ClN5OS/c21-14-8-6-13(7-9-14)17-18(16-10-11-22-12-23-16)26-19(25-17)28-20(27)24-15-4-2-1-3-5-15/h1-12H,(H,24,27)(H,25,26) |
| InChIKey | PNUINUHBZFFOLV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|