C14H9Cl2N3OS — CID 1219925
S-(1H-benzimidazol-2-yl) N-(3,4-dichlorophenyl)carbamothioate (PubChem CID 1219925) has the molecular formula C14H9Cl2N3OS and a molecular weight of 338.22 g/mol. Its IUPAC name is S-(1H-benzimidazol-2-yl) N-(3,4-dichlorophenyl)carbamothioate.
| Compound Name | S-(1H-benzimidazol-2-yl) N-(3,4-dichlorophenyl)carbamothioate |
|---|---|
| PubChem CID | 1219925 |
| Molecular Formula | C14H9Cl2N3OS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | S-(1H-benzimidazol-2-yl) N-(3,4-dichlorophenyl)carbamothioate |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H9Cl2N3OS/c15-9-6-5-8(7-10(9)16)17-14(20)21-13-18-11-3-1-2-4-12(11)19-13/h1-7H,(H,17,20)(H,18,19) |
| InChIKey | LMCRHQSLARAXNV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|