About S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate
S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate (PubChem CID 5056495) has the molecular formula C14H10N4O3S
and a molecular weight of 314.33 g/mol. Its IUPAC name is S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate.
Molecular Properties
| Compound Name | S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate |
| PubChem CID | 5056495 |
| Molecular Formula | C14H10N4O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H10N4O3S/c19-14(17-11-7-3-4-8-12(11)18(20)21)22-13-15-9-5-1-2-6-10(9)16-13/h1-8H,(H,15,16)(H,17,19) |
| InChIKey | YALRJKKEOFGFPT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 100.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate?
The IUPAC name of S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate (CID 5056495) is S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate.
What is the SMILES notation for S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate?
The canonical SMILES for S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate is O=C(Nc1ccccc1[N+](=O)[O-])Sc1nc2ccccc2[nH]1.
What is the InChIKey of S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate?
The InChIKey is YALRJKKEOFGFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4O3S/c19-14(17-11-7-3-4-8-12(11)18(20)21)22-13-15-9-5-1-2-6-10(9)16-13/h1-8H,(H,15,16)(H,17,19).
What are the key properties of S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate?
S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate has a molecular weight of 314.33 g/mol, XLogP of 3.80, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1H-benzimidazol-2-yl) N-(2-nitrophenyl)carbamothioate is sourced from PubChem (CID 5056495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).