C16H15N3OS — CID 3068383
S-(1H-benzimidazol-2-yl) 2-(2-methylanilino)ethanethioate (PubChem CID 3068383) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is S-(1H-benzimidazol-2-yl) 2-(2-methylanilino)ethanethioate.
| Compound Name | S-(1H-benzimidazol-2-yl) 2-(2-methylanilino)ethanethioate |
|---|---|
| PubChem CID | 3068383 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | S-(1H-benzimidazol-2-yl) 2-(2-methylanilino)ethanethioate |
| SMILES | Cc1ccccc1NCC(=O)Sc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H15N3OS/c1-11-6-2-3-7-12(11)17-10-15(20)21-16-18-13-8-4-5-9-14(13)19-16/h2-9,17H,10H2,1H3,(H,18,19) |
| InChIKey | DUIVDAQNVYDUTJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|