C15H10Cl4F3N3O — CID 3127857
N-[2,2,2-trichloro-1-[3-chloro-4-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxamide (PubChem CID 3127857) has the molecular formula C15H10Cl4F3N3O and a molecular weight of 447.07 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-[3-chloro-4-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-[3-chloro-4-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3127857 |
| Molecular Formula | C15H10Cl4F3N3O |
| Molecular Weight | 447.07 g/mol |
| Exact Mass | 444.95 |
| IUPAC Name | N-[2,2,2-trichloro-1-[3-chloro-4-(trifluoromethyl)anilino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(Nc1ccc(C(F)(F)F)c(Cl)c1)C(Cl)(Cl)Cl)c1cccnc1 |
| InChI | InChI=1S/C15H10Cl4F3N3O/c16-11-6-9(3-4-10(11)15(20,21)22)24-13(14(17,18)19)25-12(26)8-2-1-5-23-7-8/h1-7,13,24H,(H,25,26) |
| InChIKey | JJUQEDDJVHWNOA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.07 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|