C22H17Cl3N6O3S — CID 98334632
2-nitro-N-[(1S)-2,2,2-trichloro-1-[(4-phenyldiazenylphenyl)carbamothioylamino]ethyl]benzamide (PubChem CID 98334632) has the molecular formula C22H17Cl3N6O3S and a molecular weight of 551.84 g/mol. Its IUPAC name is 2-nitro-N-[(1S)-2,2,2-trichloro-1-[(4-phenyldiazenylphenyl)carbamothioylamino]ethyl]benzamide.
| Compound Name | 2-nitro-N-[(1S)-2,2,2-trichloro-1-[(4-phenyldiazenylphenyl)carbamothioylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 98334632 |
| Molecular Formula | C22H17Cl3N6O3S |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 550.01 |
| IUPAC Name | 2-nitro-N-[(1S)-2,2,2-trichloro-1-[(4-phenyldiazenylphenyl)carbamothioylamino]ethyl]benzamide |
| SMILES | O=C(N[C@@H](NC(=S)Nc1ccc(/N=N/c2ccccc2)cc1)C(Cl)(Cl)Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17Cl3N6O3S/c23-22(24,25)20(27-19(32)17-8-4-5-9-18(17)31(33)34)28-21(35)26-14-10-12-16(13-11-14)30-29-15-6-2-1-3-7-15/h1-13,20H,(H,27,32)(H2,26,28,35)/b30-29+/t20-/m0/s1 |
| InChIKey | OAGCQXQUUIRADQ-ZLBRTXFESA-N |
| XLogP | 6.42 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|