C17H13Cl3N4O5S — CID 2829906
3-[[2,2,2-trichloro-1-[(2-nitrobenzoyl)amino]ethyl]carbamothioylamino]benzoic acid (PubChem CID 2829906) has the molecular formula C17H13Cl3N4O5S and a molecular weight of 491.74 g/mol. Its IUPAC name is 3-[[2,2,2-trichloro-1-[(2-nitrobenzoyl)amino]ethyl]carbamothioylamino]benzoic acid.
| Compound Name | 3-[[2,2,2-trichloro-1-[(2-nitrobenzoyl)amino]ethyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 2829906 |
| Molecular Formula | C17H13Cl3N4O5S |
| Molecular Weight | 491.74 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | 3-[[2,2,2-trichloro-1-[(2-nitrobenzoyl)amino]ethyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=S)NC(NC(=O)c2ccccc2[N+](=O)[O-])C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C17H13Cl3N4O5S/c18-17(19,20)15(22-13(25)11-6-1-2-7-12(11)24(28)29)23-16(30)21-10-5-3-4-9(8-10)14(26)27/h1-8,15H,(H,22,25)(H,26,27)(H2,21,23,30) |
| InChIKey | ROYRRLXVBMHJCO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|