C13H16Cl3N3O3 — CID 2302536
3-methyl-N-[(1R)-2,2,2-trichloro-1-(3-nitroanilino)ethyl]butanamide (PubChem CID 2302536) has the molecular formula C13H16Cl3N3O3 and a molecular weight of 368.65 g/mol. Its IUPAC name is 3-methyl-N-[(1R)-2,2,2-trichloro-1-(3-nitroanilino)ethyl]butanamide.
| Compound Name | 3-methyl-N-[(1R)-2,2,2-trichloro-1-(3-nitroanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 2302536 |
| Molecular Formula | C13H16Cl3N3O3 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 3-methyl-N-[(1R)-2,2,2-trichloro-1-(3-nitroanilino)ethyl]butanamide |
| SMILES | CC(C)CC(=O)N[C@@H](Nc1cccc([N+](=O)[O-])c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H16Cl3N3O3/c1-8(2)6-11(20)18-12(13(14,15)16)17-9-4-3-5-10(7-9)19(21)22/h3-5,7-8,12,17H,6H2,1-2H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | MYEMHFJLMAREEO-GFCCVEGCSA-N |
| XLogP | 3.87 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|