C16H14Cl3N3O4 — CID 2831319
4-methoxy-N-[2,2,2-trichloro-1-(3-nitroanilino)ethyl]benzamide (PubChem CID 2831319) has the molecular formula C16H14Cl3N3O4 and a molecular weight of 418.66 g/mol. Its IUPAC name is 4-methoxy-N-[2,2,2-trichloro-1-(3-nitroanilino)ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2,2,2-trichloro-1-(3-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 2831319 |
| Molecular Formula | C16H14Cl3N3O4 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 4-methoxy-N-[2,2,2-trichloro-1-(3-nitroanilino)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(Nc2cccc([N+](=O)[O-])c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H14Cl3N3O4/c1-26-13-7-5-10(6-8-13)14(23)21-15(16(17,18)19)20-11-3-2-4-12(9-11)22(24)25/h2-9,15,20H,1H3,(H,21,23) |
| InChIKey | FZNZJMSQGWPGKO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|