C16H14Cl3N5O5S2 — CID 3728853
1-(2-methoxy-5-nitrophenyl)-3-[2,2,2-trichloro-1-[(2-nitrophenyl)sulfanylamino]ethyl]thiourea (PubChem CID 3728853) has the molecular formula C16H14Cl3N5O5S2 and a molecular weight of 526.81 g/mol. Its IUPAC name is 1-(2-methoxy-5-nitrophenyl)-3-[2,2,2-trichloro-1-[(2-nitrophenyl)sulfanylamino]ethyl]thiourea.
| Compound Name | 1-(2-methoxy-5-nitrophenyl)-3-[2,2,2-trichloro-1-[(2-nitrophenyl)sulfanylamino]ethyl]thiourea |
|---|---|
| PubChem CID | 3728853 |
| Molecular Formula | C16H14Cl3N5O5S2 |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 524.95 |
| IUPAC Name | 1-(2-methoxy-5-nitrophenyl)-3-[2,2,2-trichloro-1-[(2-nitrophenyl)sulfanylamino]ethyl]thiourea |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=S)NC(NSc1ccccc1[N+](=O)[O-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H14Cl3N5O5S2/c1-29-12-7-6-9(23(25)26)8-10(12)20-15(30)21-14(16(17,18)19)22-31-13-5-3-2-4-11(13)24(27)28/h2-8,14,22H,1H3,(H2,20,21,30) |
| InChIKey | GVMGHXNXGLNLSO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|