C15H12BrCl3N4O2S2 — CID 45155633
1-(4-bromophenyl)-3-[2,2,2-trichloro-1-[(2-nitrophenyl)sulfanylamino]ethyl]thiourea (PubChem CID 45155633) has the molecular formula C15H12BrCl3N4O2S2 and a molecular weight of 530.68 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[2,2,2-trichloro-1-[(2-nitrophenyl)sulfanylamino]ethyl]thiourea.
| Compound Name | 1-(4-bromophenyl)-3-[2,2,2-trichloro-1-[(2-nitrophenyl)sulfanylamino]ethyl]thiourea |
|---|---|
| PubChem CID | 45155633 |
| Molecular Formula | C15H12BrCl3N4O2S2 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 527.87 |
| IUPAC Name | 1-(4-bromophenyl)-3-[2,2,2-trichloro-1-[(2-nitrophenyl)sulfanylamino]ethyl]thiourea |
| SMILES | O=[N+]([O-])c1ccccc1SNC(NC(=S)Nc1ccc(Br)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H12BrCl3N4O2S2/c16-9-5-7-10(8-6-9)20-14(26)21-13(15(17,18)19)22-27-12-4-2-1-3-11(12)23(24)25/h1-8,13,22H,(H2,20,21,26) |
| InChIKey | VURUKHBYKDGOFF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|