C26H26N2O5 — CID 159611555
(3R)-5-(3,4-dimethylphenyl)-N-(2-methoxy-5-nitrophenyl)-4-oxo-3-phenylpentanamide (PubChem CID 159611555) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is (3R)-5-(3,4-dimethylphenyl)-N-(2-methoxy-5-nitrophenyl)-4-oxo-3-phenylpentanamide.
| Compound Name | (3R)-5-(3,4-dimethylphenyl)-N-(2-methoxy-5-nitrophenyl)-4-oxo-3-phenylpentanamide |
|---|---|
| PubChem CID | 159611555 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (3R)-5-(3,4-dimethylphenyl)-N-(2-methoxy-5-nitrophenyl)-4-oxo-3-phenylpentanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CC(C(=O)Cc1ccc(C)c(C)c1)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O5/c1-17-9-10-19(13-18(17)2)14-24(29)22(20-7-5-4-6-8-20)16-26(30)27-23-15-21(28(31)32)11-12-25(23)33-3/h4-13,15,22H,14,16H2,1-3H3,(H,27,30) |
| InChIKey | YDIFHDROJCNARM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|