C14H14BrCl3N2O4 — CID 4620724
[2,2,2-trichloro-1-(morpholine-4-carbonylamino)ethyl] 4-bromobenzoate (PubChem CID 4620724) has the molecular formula C14H14BrCl3N2O4 and a molecular weight of 460.54 g/mol. Its IUPAC name is [2,2,2-trichloro-1-(morpholine-4-carbonylamino)ethyl] 4-bromobenzoate.
| Compound Name | [2,2,2-trichloro-1-(morpholine-4-carbonylamino)ethyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 4620724 |
| Molecular Formula | C14H14BrCl3N2O4 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | [2,2,2-trichloro-1-(morpholine-4-carbonylamino)ethyl] 4-bromobenzoate |
| SMILES | O=C(OC(NC(=O)N1CCOCC1)C(Cl)(Cl)Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H14BrCl3N2O4/c15-10-3-1-9(2-4-10)11(21)24-12(14(16,17)18)19-13(22)20-5-7-23-8-6-20/h1-4,12H,5-8H2,(H,19,22) |
| InChIKey | BZOOIJBMFJBPFE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|