C13H22Cl3N3O2S — CID 7032079
N-[(1R)-2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]hexanamide (PubChem CID 7032079) has the molecular formula C13H22Cl3N3O2S and a molecular weight of 390.76 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]hexanamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]hexanamide |
|---|---|
| PubChem CID | 7032079 |
| Molecular Formula | C13H22Cl3N3O2S |
| Molecular Weight | 390.76 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-(morpholine-4-carbothioylamino)ethyl]hexanamide |
| SMILES | CCCCCC(=O)NC(NC(=S)N1CCOCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H22Cl3N3O2S/c1-2-3-4-5-10(20)17-11(13(14,15)16)18-12(22)19-6-8-21-9-7-19/h11H,2-9H2,1H3,(H,17,20)(H,18,22) |
| InChIKey | KNTDLMGIWNBELZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.76 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|