C19H18O2 — CID 75115780
5-hydroxy-1,7-diphenylhepta-4,6-dien-3-one (PubChem CID 75115780) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 5-hydroxy-1,7-diphenylhepta-4,6-dien-3-one.
| Compound Name | 5-hydroxy-1,7-diphenylhepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 75115780 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 5-hydroxy-1,7-diphenylhepta-4,6-dien-3-one |
| SMILES | O=C(C=C(O)C=Cc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H18O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-11,13,15,20H,12,14H2 |
| InChIKey | MJCANANSGRMBIC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|