C9H13F4NO2 — CID 145002198
4-[(E)-2-ethoxy-1,3,3,3-tetrafluoroprop-1-enyl]morpholine (PubChem CID 145002198) has the molecular formula C9H13F4NO2 and a molecular weight of 243.20 g/mol. Its IUPAC name is 4-[(E)-2-ethoxy-1,3,3,3-tetrafluoroprop-1-enyl]morpholine.
| Compound Name | 4-[(E)-2-ethoxy-1,3,3,3-tetrafluoroprop-1-enyl]morpholine |
|---|---|
| PubChem CID | 145002198 |
| Molecular Formula | C9H13F4NO2 |
| Molecular Weight | 243.20 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-[(E)-2-ethoxy-1,3,3,3-tetrafluoroprop-1-enyl]morpholine |
| SMILES | CCO/C(=C(/F)N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C9H13F4NO2/c1-2-16-7(9(11,12)13)8(10)14-3-5-15-6-4-14/h2-6H2,1H3/b8-7- |
| InChIKey | DXFOWSUDGQEEMQ-FPLPWBNLSA-N |
| XLogP | 2.06 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|