C10H14F3NO3 — CID 56965667
(E)-4-ethoxy-1,1,1-trifluoro-4-morpholin-4-ylbut-3-en-2-one (PubChem CID 56965667) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is (E)-4-ethoxy-1,1,1-trifluoro-4-morpholin-4-ylbut-3-en-2-one.
| Compound Name | (E)-4-ethoxy-1,1,1-trifluoro-4-morpholin-4-ylbut-3-en-2-one |
|---|---|
| PubChem CID | 56965667 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (E)-4-ethoxy-1,1,1-trifluoro-4-morpholin-4-ylbut-3-en-2-one |
| SMILES | CCO/C(=C/C(=O)C(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C10H14F3NO3/c1-2-17-9(7-8(15)10(11,12)13)14-3-5-16-6-4-14/h7H,2-6H2,1H3/b9-7+ |
| InChIKey | ZRZIPUTWHZAYAJ-VQHVLOKHSA-N |
| XLogP | 1.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|