C13H21BrF3NO — CID 15893136
4-[(Z)-3-bromo-1,1,1-trifluoronon-2-en-2-yl]morpholine (PubChem CID 15893136) has the molecular formula C13H21BrF3NO and a molecular weight of 344.22 g/mol. Its IUPAC name is 4-[(Z)-3-bromo-1,1,1-trifluoronon-2-en-2-yl]morpholine.
| Compound Name | 4-[(Z)-3-bromo-1,1,1-trifluoronon-2-en-2-yl]morpholine |
|---|---|
| PubChem CID | 15893136 |
| Molecular Formula | C13H21BrF3NO |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 4-[(Z)-3-bromo-1,1,1-trifluoronon-2-en-2-yl]morpholine |
| SMILES | CCCCCC/C(Br)=C(/N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C13H21BrF3NO/c1-2-3-4-5-6-11(14)12(13(15,16)17)18-7-9-19-10-8-18/h2-10H2,1H3/b12-11- |
| InChIKey | XYCJUKSXEUJBRT-QXMHVHEDSA-N |
| XLogP | 4.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|