About 2-bromooct-1-ene-1,1-diol
2-bromooct-1-ene-1,1-diol (PubChem CID 118275570) has the molecular formula C8H15BrO2
and a molecular weight of 223.11 g/mol. Its IUPAC name is 2-bromooct-1-ene-1,1-diol.
Molecular Properties
| Compound Name | 2-bromooct-1-ene-1,1-diol |
| PubChem CID | 118275570 |
| Molecular Formula | C8H15BrO2 |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2-bromooct-1-ene-1,1-diol |
| SMILES | CCCCCCC(Br)=C(O)O |
| InChI | InChI=1S/C8H15BrO2/c1-2-3-4-5-6-7(9)8(10)11/h10-11H,2-6H2,1H3 |
| InChIKey | MZZRXKZYIYXIEX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromooct-1-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromooct-1-ene-1,1-diol?
The IUPAC name of 2-bromooct-1-ene-1,1-diol (CID 118275570) is 2-bromooct-1-ene-1,1-diol.
What is the SMILES notation for 2-bromooct-1-ene-1,1-diol?
The canonical SMILES for 2-bromooct-1-ene-1,1-diol is CCCCCCC(Br)=C(O)O.
What is the InChIKey of 2-bromooct-1-ene-1,1-diol?
The InChIKey is MZZRXKZYIYXIEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15BrO2/c1-2-3-4-5-6-7(9)8(10)11/h10-11H,2-6H2,1H3.
What are the key properties of 2-bromooct-1-ene-1,1-diol?
2-bromooct-1-ene-1,1-diol has a molecular weight of 223.11 g/mol, XLogP of 3.64, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromooct-1-ene-1,1-diol is sourced from PubChem (CID 118275570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).