About heptanoic acid;methane
heptanoic acid;methane (PubChem CID 159146715) has the molecular formula C9H22O2
and a molecular weight of 162.27 g/mol. Its IUPAC name is heptanoic acid;methane.
Molecular Properties
| Compound Name | heptanoic acid;methane |
| PubChem CID | 159146715 |
| Molecular Formula | C9H22O2 |
| Molecular Weight | 162.27 g/mol |
| Exact Mass | 162.16 |
| IUPAC Name | heptanoic acid;methane |
| SMILES | C.C.CCCCCCC(=O)O |
| InChI | InChI=1S/C7H14O2.2CH4/c1-2-3-4-5-6-7(8)9;;/h2-6H2,1H3,(H,8,9);2*1H4 |
| InChIKey | KITQLLDVEBBHMC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptanoic acid;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptanoic acid;methane?
The IUPAC name of heptanoic acid;methane (CID 159146715) is heptanoic acid;methane.
What is the SMILES notation for heptanoic acid;methane?
The canonical SMILES for heptanoic acid;methane is C.C.CCCCCCC(=O)O.
What is the InChIKey of heptanoic acid;methane?
The InChIKey is KITQLLDVEBBHMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.2CH4/c1-2-3-4-5-6-7(8)9;;/h2-6H2,1H3,(H,8,9);2*1H4.
What are the key properties of heptanoic acid;methane?
heptanoic acid;methane has a molecular weight of 162.27 g/mol, XLogP of 3.31, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptanoic acid;methane is sourced from PubChem (CID 159146715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).