C12H20F4NO2- — CID 54333395
methylcyclopentane;1,1,2,2-tetrafluoro-2-morpholin-4-ylethanolate (PubChem CID 54333395) has the molecular formula C12H20F4NO2- and a molecular weight of 286.29 g/mol. Its IUPAC name is methylcyclopentane;1,1,2,2-tetrafluoro-2-morpholin-4-ylethanolate.
| Compound Name | methylcyclopentane;1,1,2,2-tetrafluoro-2-morpholin-4-ylethanolate |
|---|---|
| PubChem CID | 54333395 |
| Molecular Formula | C12H20F4NO2- |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methylcyclopentane;1,1,2,2-tetrafluoro-2-morpholin-4-ylethanolate |
| SMILES | CC1CCCC1.[O-]C(F)(F)C(F)(F)N1CCOCC1 |
| InChI | InChI=1S/C6H8F4NO2.C6H12/c7-5(8,6(9,10)12)11-1-3-13-4-2-11;1-6-4-2-3-5-6/h1-4H2;6H,2-5H2,1H3/q-1; |
| InChIKey | SZXJZUWBJKSHKN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|